**This is a beta version of MetaNetX/MNXref, MNXref identifiers may not be final**

acetate

Properties Image Occurences in reactions MNX_ID MNXM26 #reac in my sandbox 0 in MNXref (generic) 610 in models (compartimentalized) 228 formula C2H3O2 charge -1 mass 59.044 reference chebi:30089 InChIKey QTBSBXVTEAMEQO-UHFFFAOYSA-M InChI InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1 SMILES [CH3:1][C:2](=[O:3])[OH:4]
Parent-child relations graph	Deprecated MNXref IDs graph

Similar chemical compounds in external resources

Identifier	Description
reactome:R-ALL-113539 reactomeM:R-ALL-113539 reactome:R-ALL-1524044 reactomeM:R-ALL-1524044 reactome:R-ALL-5566518 reactomeM:R-ALL-5566518 reactome:R-ALL-9717939 reactomeM:R-ALL-9717939 reactome:R-ALL-9749588 reactomeM:R-ALL-9749588 CHEBI:30089 chebi:30089	acetate ACETATE ION Azetat CH3-COO(-) Ethanoat MeCO2 anion acetic acid, ion(1-) ethanoate
bigg.metabolite:ac biggM:ac envipath:...efa015b481ea envipathM:...efa015b481ea	Acetate
seed.compound:cpd00029 seedM:cpd00029	Acetate ACET Acetic acid Ethanoic acid Glacial acetic acid ac acetate acetic acid ethanoic acid
kegg.compound:C00033 keggC:C00033	Acetate Acetic acid Ethanoic acid
sabiork.compound:1278 sabiorkM:1278	Acetate Acetic acid Ethanoic acid Glacial acetic acid
vmhM:ac vmhmetabolite:ac	Acetate acetic acid
envipath:...3be380a9d3c0 envipathM:...3be380a9d3c0 envipath:...c8551ca87c02 envipathM:...c8551ca87c02	Acetic acid
kegg.drug:D00010 keggD:D00010	Acetic acid, glacial (USP) Acetasol (TN) Acetic acid (JP18/NF) Glacial acetic acid (JP18)
lipidmaps:LMFA01010002 lipidmapsM:LMFA01010002	Acetic acid 10.Methanecarboxylic acid C2:0 FA 2:0 Vinegar acid acetate ethanoic acid
hmdb:HMDB0000042	Acetic acid AcOH Acetasol Acetate Acetic acid glacial Acetic acid, glacial Acid glacial, acetic Acid, acetic Acid, glacial acetic Acide acetique CH3-COOH CH3CO2H Essigsaeure Ethanoate Ethanoic acid Ethoate Ethoic acid Ethylate Ethylic acid Glacial acetate Glacial acetic acid Glacial, acetic acid HOAc INS no. 260 Kyselina octova MeCO2h MeCOOH Methanecarboxylate Methanecarboxylic acid Vinegar Vinegar acid acetic acid e 260 e-260 e260
envipath:...359c4b9bbf9e envipathM:...359c4b9bbf9e envipath:...26012d7f9bf4 envipathM:...26012d7f9bf4	Spike compound 0000415
SLM:000000449 slm:000000449	acetate
metacyc.compound:ACET metacycM:ACET	acetate acetic acid ethanoate
CHEBI:193049 chebi:193049	acetic acid-d4 (2H3)acetic (2H)acid CD3COOD deuterated acetic acid deuterio 2,2,2-trideuterioacetate tetradeuteroacetic acid
reactome:R-ALL-2022890 reactomeM:R-ALL-2022890 reactome:R-ALL-29416 reactomeM:R-ALL-29416 reactome:R-ALL-372540 reactomeM:R-ALL-372540 reactome:R-ALL-390305 reactomeM:R-ALL-390305 reactome:R-ALL-427486 reactomeM:R-ALL-427486 reactome:R-ALL-9737107 reactomeM:R-ALL-9737107 reactome:R-ALL-9737119 reactomeM:R-ALL-9737119 CHEBI:15366 chebi:15366	acetic acid ACETIC ACID AcOH Acetic acid CH3-COOH CH3CO2H E 260 E-260 E260 Essigsaeure Ethanoic acid Ethylic acid HOAc INS No. 260 MeCO2H MeCOOH Methanecarboxylic acid acide acetique ethoic acid
metacyc.compound:CPD-24335 metacycM:CPD-24335	acetic acid ethanoic acid
envipath:...91a3d615e3d8 envipathM:...91a3d615e3d8	compound 0000076
envipath:...a516a0ead4b3 envipathM:...a516a0ead4b3	compound 0040212
hmdb:HMDB00042 chebi:13704 chebi:22165 chebi:22169 chebi:2387 chebi:40480 chebi:40486 biggM:M_ac keggC:M_C00033 keggD:M_D00010 seedM:M_cpd00029	secondary/obsolete/fantasy identifier