**This is a beta version of MetaNetX/MNXref, MNXref identifiers may not be final**
 Feedback

methionine

MNXM738804 is deprecated and here replaced by MNXM1427443
!!! Alternative mappings exist !!!
PropertiesImageOccurences in reactions
MNX_IDMNXM1427443Image of MNXM1427443
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC5H11NO2S
charge0
mass149.208
referencechebi:16811
InChIKeyFFEARJCKVFRZRR-UHFFFAOYSA-N
InChIInChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)
SMILES[CH3:1][S:9][CH2:3][CH2:2][CH:4]([NH2:6])[C:5]([OH:8])=[O:7]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16811
chebi:16811
methionine
2-Amino-4-(methylthio)butyric acid
2-amino-4-(methylsulfanyl)butanoic acid
2-amino-4-(methylthio)butanoic acid
DL-Methionine
Hmet
M
Met
Methionin
Methionine
Racemethionine
alpha-amino-gamma-methylmercaptobutyric acid
metionina
seed.compound:cpd30746
seedM:cpd30746
2-Amino-4-(methylthio)butyric acid
envipath:...8398e8723d5e
envipathM:...8398e8723d5e
Methionine
kegg.compound:C01733
keggC:C01733
Methionine
2-Amino-4-(methylthio)butyric acid
kegg.drug:D04983
keggD:D04983
Racemethionine (USAN)
DL-Methionine (JAN)
Padameth (TN)
hmdb:HMDB0033951 Racemethionine
(+-)-Methionine
(+/-)-2-amino-4-(methylmercapto)butyric acid
2-Amino-4-(methylmercapto)butyric acid
2-Amino-4-(methylsulfanyl)butanoate
2-Amino-4-(methylsulfanyl)butanoic acid
2-Amino-4-(methylsulphanyl)butanoate
2-Amino-4-(methylsulphanyl)butanoic acid
2-Amino-4-(methylthio)-butyric acid
2-Amino-4-(methylthio)butanoate
2-Amino-4-(methylthio)butanoic acid
2-Amino-4-(methylthio)butyrate
2-Amino-4-(methylthio)butyric acid
2-Amino-4-methylthiobutanoic acid
2-amino-4-(methylsulfanyl)butanoic acid
DL-2-Amino-4-(methylthio)-butyric acid
DL-2-Amino-4-(methylthio)butanoic acid
DL-2-Amino-4-(methylthio)butyric acid
DL-2-Amino-4-methylthiobutanoic acid
DL-Methionine
FEMA 3301
Hmet
L-Isomer methionine
L-Methionine
Liquimeth
M
Met
Methionin
Methionine
Methionine, L isomer
Methionine, L-isomer
Metionina
Padameth
Pedameth
Racemethionine, usan
a-Amino-g-methylmercaptobutyrate
a-Amino-g-methylmercaptobutyric acid
alpha-Amino-gamma-(methylthio)butyric acid
alpha-Amino-gamma-methylmercaptobutyrate
alpha-Amino-gamma-methylmercaptobutyric acid
alpha-amino-gamma-methylmercaptobutyrate
alpha-amino-gamma-methylmercaptobutyric acid
methionine
envipath:...e00f2d8e761f
envipathM:...e00f2d8e761f
compound 0062161
CHEBI:32644
chebi:32644
methioninate
2-amino-4-(methylsulfanyl)butanoate
met(-)
methionine anion
CHEBI:64558
chebi:64558
methionine
2-ammonio-4-(methylsulfanyl)butanoate
2-azaniumyl-4-(methylsulfanyl)butanoate
methionine zwitterion
CHEBI:32646
chebi:32646
methioninium
1-carboxy-3-(methylsulfanyl)propan-1-aminium
H2met(+)
methionine cation
hmdb:HMDB33951
chebi:14590
chebi:25229
chebi:6829
keggC:M_C01733
keggD:M_D04983
seedM:M_cpd30746
secondary/obsolete/fantasy identifier